1.2-cyclohexylenedinitrilo-tetraacetic acidApplication
(1,2-Cyclohexylenedinitrilo)tetraacetic acid (CDTA) is a chelating agent used in laboratories for various applications, including analytical chemistry and as a decomplexing agent in ion-selective electrode (ISE) measurements.
1.2-cyclohexylenedinitrilo-tetraacetic acid
Here’s a more detailed look at its lab uses:
Chelating Agent:
CDTA, like EDTA, is a chelating agent, meaning it can bind to metal ions, forming complexes.
Analytical Chemistry:
It’s used in analytical chemistry for the determination of metal ions, helping to prevent interference from other ions in the sample.
Decomplexing Agent in ISE Measurements:
In ion-selective electrode (ISE) measurements, particularly for fluoride determination, CDTA acts as a decomplexing agent, preventing the formation of interfering complexes with the analyte.
TISAB Solution:
CDTA is often a component of the Total Ionic Strength Adjustment Buffer (TISAB) solution, which is used to maintain a constant ionic strength during ISE measurements.
Other applications:
CDTA is also used in cosmetics, and has applications in water softening and food preservation.
trans-1,2-Diaminocyclohexane-N,N,N′,N′-tetraacetic acid monohydrate is a multidentate ligand{1-6} that may be used as a chelating agent in the preparation of metal-chelate complexes.
| Grade | ACS reagent |
| for complexometry | |
| InChI Key | VASZYFIKPKYGNC-DHTOPLTISA-N |
| assay | 97.5-100.5% |
| 98% | |
| ign. residue | ≤0.2% |
| mp | 213-216 °C (lit.) |
| cation traces | Fe: ≤0.005% |
| heavy metals (as Pb): ≤0.001% | |
| SMILES string | [H]O[H].OC(=O)CN(CC(O)=O)[C@@H]1CCCC[C@H]1N(CC(O)=O)CC(O)=O |
1.2-cyclohexylenedinitrilo-tetraacetic acid
